Ronidazole D3
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00244 |
| Alternative Name(s) | [1-(²H3)methyl-5-nitro-1H-imidazol-2-yl]methyl carbamate |
| Research Area | Labelled Ronidazole . Antimicrobial.;Labeled Ronidazole, intended for use as an internal standard for the quantification of Ronidazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H5D3N4O4 |
| CAS# | 1015855-87-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(OCC1=NC=C([N](=O)=O)N1C([2H])([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00244.html |
| Additional Information | NULL |