Trandolaprilat D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10095 |
| Alternative Name(s) | (2S,3aR,7aS)-1-[(2S)-2-[[]amino]propanoyle-2-carboxylic acid |
| Research Area | Labeled Trandolapril, intended for use as an internal standard for the quantification of Trandolapril by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 87679-71-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1[C@](CCCC2)([H])[C@@]2([H])C[C@H]1C(O)=O)[C@H](C)N[C@H](C(O)=O)CC([2H])C(C([2H])=C3[2H])=C(C([2H])=C3[2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10095.html |
| Additional Information | NULL |