(-)-Tramadol D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10132 |
| Alternative Name(s) | (-) (1R,2R)-2-((dimethyl D3 amino)methyl)-1-(3-methoxyphenyl)cyclohexanol |
| Research Area | Labeled Isomer of Tramadol, intended for use as an internal standard for the quantification of Tramadol by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 123134-25-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@](CCCC1)(C2=CC(OC)=CC=C2)[C@@H]1CN(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10132.html |
| Additional Information | NULL |