Piroxicam D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02991 |
| Alternative Name(s) | 4-Hydroxy-2-(methyl-d3)-N-2-pyridinyl-2H-1,2-benzothiazine-3-carboxamide 1,1-Dioxide |
| Research Area | Non-steroidal anti-inflammatory with long half-life. Cyclooxygenase inhibitor. Clinically useful NSAID.;Labeled Piroxicam, intended for use as an internal standard for the quantification of Piroxicam by GC- or LC-mass spectrometry. |
| Molecular Formula | C15H10D3N3O4S |
| CAS# | 942047-64-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=CC=CC=C1[S]2(=O)=O)=C(N2C([2H])([2H])[2H])C(NC3=CC=CC=N3)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02991.html |
| Additional Information | NULL |