Lumefantrine D18
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06738 |
| Alternative Name(s) | (9Z)-2,7ne]-α-[(dibutylamino-d18)methyl]-9H-fluorene-4-methanol; 2-(Dibutylamino-d18)-1-[2,7hlorophenyl)meth-(Z)- ylidene]-9H-fluoren-4-yl]ethanol; Benflumelol-d18; Benflumetol-d18 |
| Research Area | Inhibits hemozoin formation. Antimalarial.;Labeled Lumefantrine, intended for use as an internal standard for the quantification of Lumefantrine by GC- or LC-mass spectrometry. |
| Molecular Formula | C30H14D18Cl3NO |
| CAS# | 1185240-53-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=C(C2=CC=C(Cl)C=C2/C3=C/C4=CC=C(Cl)C=C4)C3=CC(Cl)=C1)CN(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06738.html |
| Additional Information | NULL |