Amphotericin B Methyl Ester D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10085 |
| Alternative Name(s) | Amphotericin B Methyl Ester D3;Methyl-D3 (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E, 25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-b-D- mannopyranosyl)oxy]-1,3,5,6,9,11,17,3oxo-14, 39-dioxnatriaconta-19,21,23,25,27 |
| Research Area | Labeled Amphotericin, intended for use as an internal standard for the quantification of Amphotericin by GC- or LC-mass spectrometry. |
| Molecular Formula | C48H72D3NO17 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C([C@H]1[C@@](C[C@H](/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC2=O)O[C@@](O[C@H](C)[C@@H](O)[C@@H]3N)([H])[C@H]3O)([H])O[C@](O)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](C2)O)O)O)O)O)C[C@@H]1O)OC([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10085.html |
| Additional Information | NULL |