Valsartan D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02693 |
| Alternative Name(s) | N-(1-Oxopentyl)-N-[[2’-(1H-tetrazol-5-yl)[1,1’-biphenyl]-4-yl]methyl]-L-valine-d3 |
| Research Area | Labeled Valsartan, intended for use as an internal standard for the quantification of Valsartan by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H26D3N5O3 |
| CAS# | 1331908-02-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(CCCC([2H])([2H])[2H])N([C@H](C(O)=O)C(C)C)CC1=CC=C(C2=C(C3=NN=NN3)C=CC=C2)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02693.html |
| Additional Information | NULL |