AMOZ D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-W-00167 |
| Alternative Name(s) | 3-Amino-5-(4-morpholinylmethyl)-2-oxazolidinone-d5. |
| Research Area | Labeled AMOZ, intended for use as an internal standard for the quantification of AMOZ by GC- or LC-mass spectrometry. |
| Molecular Formula | C8H10D5N3O3 |
| CAS# | 1017793-94-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NN1C([2H])([2H])C(OC1=O)([2H])C([2H])([2H])N2CCOCC2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00167.html |
| Additional Information | NULL |