Oxacillin D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-13671 |
| Alternative Name(s) | (2S,5R,6R)-3,3-dimethyl-6-[5-methyl-3-(D5)phenyl-1,2-oxazole-4-amido]-7-oxo-4-thia-1- azabicyclo[3.2.0]heptane-2-carboxylic acid. |
| Research Area | Labeled Oxacillin, intended for use as an internal standard for the quantification of Oxacillin by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H14D5N3O5S |
| CAS# | 66-79-5 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([C@@H]1N(C2=O)[C@]([C@@H]2NC(C(C(C3=C([2H])C([2H])=C([2H])C([2H])=C3[2H])=NO4)=C4C)=O)([H])SC1(C)C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13671.html |
| Additional Information | NULL |