Ractopamine D6 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10060 |
| Alternative Name(s) | 4-(1-hydroxy-2-{[4-(4-hydroxyphenyl)(1,1,1,2,3,3- D6)butan-2-yl]amino}ethyl)phenol hydrochloride |
| Research Area | A beta Adrenergic agonist. A repartitioning agent.;Labeled Ractopamine, intended for use as an internal standard for the quantification of Ractopamine by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H18D6ClNO3 |
| CAS# | 1276197-17-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=CC=C(O)C=C1)CNC(C([2H])([2H])[2H])([2H])C([2H])([2H])CC2=CC=C(O)C=C2.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10060.html |
| Additional Information | NULL |