7-Amino-3-[[(2,5-dihydro-6-hydroxy-2-methyl-5-oxo-1,2,4-triazin-3-yl)thio]methyl]cephalosporanic Acid
Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-02416 |
| Alternative Name(s) | (6R,7R)-7-Amino-8-oxo-3-[[(1,2,5,6-tetrahydro-2-methyl-5,6-dioxo-1,2,4-triazin-3-yl)thio]methyl]-5-thia-1-azc Acid |
| Research Area | An intermediate in the synthesis of cephalosporin antibiotics, Ceftriaxone and Cefixime . |
| Molecular Formula | C12H13N5O5S2 |
| CAS# | 58909-56-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(N1[C@@]2([H])[C@H](N)C1=O)=C(CS2)CSC(N(NC3=O)C)=NC3=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST02416.html |
| Additional Information | NULL |
