Methyl diethyldithiocarbamate D10
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10124 |
| Alternative Name(s) | disulfiram metabolite D10;S-Methyl N, N-Diethyldithiocarbamate-D10);N,N-bis(D5)ethyl(methylsulfanyl)carbothioamide |
| Research Area | Labeled Disulfiram, intended for use as an internal standard for the quantification of Disulfiram by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H3D10NS2 |
| CAS# | 686-07-7 Unlabeled |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | S=C(SC)N(C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10124.html |
| Additional Information | NULL |