Dabigatran Acyl-β-D-glucuronide D3 trifluoroacetate salt
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10012 |
| Alternative Name(s) | Dabigatran Acyl-β-D-glucuronide D3 trifluoroacetate salt ;Dabigatran Acyl-β-D- glucuronide SALT;N-[[2-[[[4-(Aminoiminomethyl)phenyl]amino]methyl]-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-β-alanine β-D-Glucopyranuronosyl Es |
| Research Area | Labeled glucuronide of Dabigatran, intended for use as an internal standard for the quantification of Dabigatran by GC- or LC-mass spectrometry. |
| Molecular Formula | C33H31D3F3N7O11 |
| CAS# | 1015167-40-4 (Unlabeled Free Base) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(C1=CC=CC=N1)CCC(O[C@@H]([C@@H]([C@@H](O)[C@@H]2O)O)O[C@@H]2C(O)=O)=O)C3=CC=C4N(C(CNC5=CC=C(C(N)=N)C=C5)=NC4=C3)C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10012.html |
| Additional Information | NULL |