Zonisamide D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02921 |
| Alternative Name(s) | 1,2-(Benzisoxazole-d4)-3-methanesulfonamide; 3-(Sulfamoylmethyl)-1,2-benzisoxazole-d4; AD 810-d4; |
| Research Area | Labelled sulfonamide antiseizure agent; blocks repetitive firing of voltagesensitive sodium channels and reduces voltage-sensitive T-type calcium currents. Heterocyclic methanesulfonide with anticonvulsant properties. The compound is under investigation f;Labeled Zonisamide, intended for use as an internal standard for the quantification of Zonisamide by GC- or LC-mass spectrometry. |
| Molecular Formula | C8H4D4N2O3S |
| CAS# | 1020720-04-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[S](CC(C1=C(C([2H])=C2[2H])[2H])=NOC1=C2[2H])(=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02921.html |
| Additional Information | NULL |