Tizoxanide Sulfate
Fine Chemicals
| Trivial name | NULL |
| Catalog Number | CS-T-44470 |
| Alternative Name(s) | 2-Sulfooxy-N-(5-nitro-2-thiazolyl)benzamide;2-((5-nitrothiazol-2-yl)carbamoyl)phenyl hydrogen sulfate |
| Research Area | Tizoxanide Sulfate is the sulfate conjugate of Tizoxanide . |
| Molecular Formula | C10H7N3O7S2 |
| CAS# | 1391053-06-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C=CC=C1)=C1O[S](=O)(O)=O)NC2=NC=C([N+]([O-])=O)S2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST44470.html |
| Additional Information | NULL |