Nitenpyram D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15084 |
| Alternative Name(s) | [(E)-1-{[(6-chloropyridin-3-yl)methyl]amino}-2- nitroethenyl](D5)ethylmethylamine |
| Research Area | Labeled Nitenpyram, intended for use as an internal standard for the quantification of Nitenpyram by GC- or LC-mass spectrometry. |
| Molecular Formula | C11H10D5ClN4O2 |
| CAS# | 150824-47-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN/C(N(C([2H])([2H])C([2H])([2H])[2H])CC1=CN=C(Cl)C=C1)=C[N](=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15084.html |
| Additional Information | NULL |