β-1,2,3,4,5,6-Hexachlorocyclohexane
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-T-55552 |
| Alternative Name(s) | Beta-Hexachlorocyclohexane;(1a,2-Beta,3a,4-Beta,5a,6-Beta)-1,2,3,4,5,6-Hta hexachloride; -Beta-HCH; -Beta-Hexachloran; -Beta-Hexachlorobenzene; -Beta-Hexachlorocyclohexane; -Beta-Lindane |
| Research Area | -Beta-1,2,3,4,5,6-Hexachlorocyclohexane is an organochloride which is one of the isomers of hexachlorocyclohexane and is also an byproduct of insecticide Lindane. |
| Molecular Formula | C6H6Cl6 |
| CAS# | 319-85-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | Cl[C@H]([C@H]([C@H](Cl)[C@H]1Cl)Cl)[C@@H]([C@H]1Cl)Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST55552.html |
| Additional Information | NULL |