Tigecycline D9
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10381 |
| Alternative Name(s) | (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-3,10,12,12a-tetrahydroxy-9-(2-{[2-(D3)methyl(1,1,1,3,3,3-D6)propan-2-yl]amino}acetamido)-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| Research Area | A glycylcycline antibiotic, used to treat infection by drug resistant bacteria such as Staphylococcus aureus (Staph aureus) and Acinetobacter baumannii. This is the labeled analog. |
| Molecular Formula | C29H30D9N5O8 |
| CAS# | 220620-09-7 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](C(O)=C(C(C1=C(C(NC(CNC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])=O)=C2)O)=O)[C@](CC1=C2N(C)C)([H])C3)(C(C(C(N)=O)=C4O)=O)[C@]3([H])[C@@H]4N(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10381.html |
| Additional Information | NULL |