Xanthorrhizol
API Standards
| Trivial name | NULL |
| Catalog Number | CS-T-62779 |
| Alternative Name(s) | (R)-2-methyl-5-(6-methylhept-5-en-2-yl)phenol |
| Research Area | Xanthorrhizol is a nautral sesquiterpenoid from the rhizome of Curcuma xanthorrhiza that induces apoptosis and growth arrest in HCT116 human colon cancer cells. |
| Molecular Formula | C15H22O |
| CAS# | 30199-26-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H](C1=CC(O)=C(C)C=C1)CC/C=C(C)/C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST62779.html |
| Additional Information | NULL |