Sulfaphenazole
API Standards
| Trivial name | NULL |
| Catalog Number | CS-T-42785 |
| Alternative Name(s) | 4-Amino-N-(1-phenyl-1H-pyrazol-5-yl)benzenesulfonamide;4-Amino-N-(1-phenyl-1H-pyrazol-5-yl)benzenesulfonamide |
| Research Area | Sulfaphenazole is used as an inhibitor for mammalian CYP2C9, an enzyme of the cytochrome P450 family allowing for pharmacological application. |
| Molecular Formula | C15H14N4O2S |
| CAS# | 526-08-09 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC1=CC=C(S(=O)(NC2=CC=NN2C3=CC=CC=C3)=O)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST42785.html |
| Additional Information | NULL |