Ropinirole Related Compound B
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-03611 |
| Alternative Name(s) | Ropinirole Related Compound B;3-Oxo Ropinirole HCl;Ropinirole Impurity B;4-(2-(dipropylamino)ethyl)indoline-2,3-dionehydrochloride;3-Oxo Ropinirole Hydrochloride. |
| Research Area | A related impurity of Ropinirole, potentially formed during its synthesis. Useful as antihypertensives and antianginal agents.;Impurity in commercial preparations of Ropinirole |
| Molecular Formula | C16H22N2O2.HCl |
| CAS# | 221264-21-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C(C(CCN(CCC)CCC)=CC=C2)=C2NC1=O.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03611.html |
| Additional Information | NULL |