Rupatadine D6 Tartrate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06947 |
| Alternative Name(s) | 13-chloro-2-{1-[(5-methylpyridin-3-yl)(?H₂)methyl](2,3,5,6-D4)piperidin-4-ylidene}-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene; 2,3-dihydroxybutanedioic acid |
| Research Area | Labeled Rupatadine, intended for use as an internal standard for the quantification of Rupatadine by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 913746-30-2 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C(O)=O)[C@@H](O)C(O)=O.ClC1=CC=C2C(CCC3=C(N=CC=C3)/C2=C4C([2H])C([2H])N(C([2H])([2H])C5=CN=CC(C)=C5)C([2H])C4[2H])=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06947.html |
| Additional Information | NULL |