Rosiglitazone D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06941 |
| Alternative Name(s) | 5-[(4-{2-[(H3)methyl(pyridin-2-yl)amino]ethoxy}phenyl)methyl]-1,3-thiazolidine-2,4-dione |
| Research Area | Labeled Rosiglitazone, intended for use as an internal standard for the quantification of Rosiglitazone by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H16D3N3O3S |
| CAS# | 1132641-22-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1)C(SC1=O)CC2=CC=C(OCCN(C3=CC=CC=N3)C([2H])([2H])[2H])C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06941.html |
| Additional Information | NULL |