Rosuvastatin Sodium D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06943 |
| Alternative Name(s) | 7-[4-(4-Fluorophenyl)-6-(1-methylethyl-d6)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]-3,5-dihydroxy-6-heptenoic Acid Sodium Salt |
| Research Area | Labeled Rosuvastatin, intended for use as an internal standard for the quantification of Rosuvastatin by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H21FN3O6SD6Na |
| CAS# | 2070009-41-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C[C@@H](O)CC([O-])=O)/C=C/C(C(C1=CC=C(F)C=C1)=NC(N(C)[S](C)(=O)=O)=N2)=C2C(C([2H])([2H])[2H])C([2H])([2H])[2H].[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06943.html |
| Additional Information | NULL |