Heptachlor
Marine
| Trivial name | NULL |
| Catalog Number | CS-T-55517 |
| Alternative Name(s) | 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-1H-4,7-methanoindene |
| Research Area | Heptachlor is an organochlorine pesticide/insecticide used in the protection of crops from pests. |
| Molecular Formula | C10H5Cl7 |
| CAS# | 76-44-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1(C(Cl)=C2Cl)C(C3Cl)C(C=C3)C2(Cl)C1(Cl)Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST55517.html |
| Additional Information | NULL |