Sibutramine D3 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06960 |
| Alternative Name(s) | Yeduc;MERIDIA ;REDUCTIL ;BTS 54524;SIBUTRAMINE D3 HCL;Unii-ogm0yhd1wf D3;Sibutramine hydrochl D3;Meridia Hydrochloride D3;Reductil Hydrochloride D3;SIBUTRAMINE HCL D3 99% MIN |
| Research Area | Labeled Sibutramine, intended for use as an internal standard for the quantification of Sibutramine by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 84485-00-7 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C([2H])([2H])[2H])C(C1(C2=CC=C(Cl)C=C2)CCC1)CC(C)C.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06960.html |
| Additional Information | NULL |