Betahistine D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02661 |
| Alternative Name(s) | (H3)methyl[2-(pyridin-2-yl)ethyl]amine;CS-T-55664 |
| Research Area | Labeled Betahistine, intended for use as an internal standard for the quantification of Betahistine by GC- or LC-mass spectrometry. |
| Molecular Formula | C8H9D3N2 |
| CAS# | 244094-70-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C([2H])([2H])NCCC1=CC=CC=N1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02661.html |
| Additional Information | NULL |