Sulfathiazole 13C6
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00269 |
| Alternative Name(s) | 4-amino-N-(1,3-thiazol-2-yl)(1,2,3,4,5,6- 13C6)benzene-1-sulfonamide |
| Research Area | Labeled Sulfathiazole, intended for use as an internal standard for the quantification of Sulfathiazole by GC- or LC-mass spectrometry. |
| Molecular Formula | 13C6C3H9N3O2S2 |
| CAS# | 1196157-72-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](NC1=NC=CS1)([13C]2=[13CH][13CH]=[13C](N)[13CH]=[13CH]2)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00269.html |
| Additional Information | NULL |