Sitagliptin EP Impurity A
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-08190 |
| Alternative Name(s) | (3S)-3-amino-1-[3-(trifluoromethyl)-5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one; (S)-Sitagliptin ; S-isomer of Sitagliptin |
| Research Area | Impurity in commercial preparations of Sitagliptin. ent-Sitagliptin Phosphate is the S-isomer of Sitagliptin Phosphate, as an impurity. |
| Molecular Formula | C16H15F6N5O |
| CAS# | 823817-55-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[P](O)(O)O.FC(F)(C1=NN=C2N1CCN(C(C[C@@H](N)CC(C=C(F)C(F)=C3)=C3F)=O)C2)F |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO08190.html |
| Additional Information | NULL |