Sapropterin 13C 15N3 bistrifluoroacetate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03245 |
| Alternative Name(s) | (6S)-2-amino-6-[(1S,2S)-1,2-dihydroxypropyl]- 1,4,5,6,7,8-hexahydro(8a-¹³C,1,3-¹5N2)pteridin-4- one; bis(trifluoroacetic acid) |
| Research Area | Labeled Sapropterin, intended for use as an internal standard for the quantification of Sapropterin by GC- or LC-mass spectrometry. |
| Molecular Formula | C12[13C]H17F6N2[15N]3O7 |
| CAS# | 17528-72-2 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(F)(F)F)=O.OC(C(F)(F)F)=O.O=C([15NH]=C([15NH2])[15NH]1)C2=[13C]1NC[C@@]([C@@H](O)[C@@H](O)C)([H])N2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03245.html |
| Additional Information | NULL |