Penciclovir D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10927 |
| Alternative Name(s) | 2-Amino-1,9-dihydro-9-[4-hydroxy-3-(hydroxymethyl)butyl]-6H-purin-6-one-d4 |
| Research Area | A deuterated version of Penciclovir, an antiviral.;Labeled Penciclovir, intended for use as an internal standard for the quantification of Penciclovir by GC- or LC-mass spectrometry. |
| Molecular Formula | C10H11D4N5O3 |
| CAS# | 1020719-72-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OCC(CO)C([2H])([2H])C([2H])([2H])N1C(NC(N)=NC2=O)=C2N=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10927.html |
| Additional Information | NULL |
