N-Methylpiperazine D8 dihydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16355 |
| Alternative Name(s) | 1-methyl(2,2,3,3,5,5,6,6-D8)piperazine dihydrochloride |
| Research Area | Labeled Piperazine, intended for use as an internal standard for the quantification of Piperazine by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 917358-65-7 (Freebase) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN1C([2H])([2H])C([2H])([2H])NC([2H])([2H])C1([2H])[2H].Cl.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16355.html |
| Additional Information | NULL |