Benzyl bromide D7
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-10415 |
| Alternative Name(s) | 1-[bromo(D2)methyl](D5)benzene |
| Research Area | Benzyl-d7 Bromide is the isotope labelled analog of Benzyl Bromide (B233650); a compound used in organic synthesis for the introduction of the benzyl protecting group for alcohols and carboxylic acids. |
| Molecular Formula | C7D7Br |
| CAS# | 35656-93-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | BrC([2H])([2H])C(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10415.html |
| Additional Information | NULL |