Tryptophan EP Impurity A
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-54496 |
| Alternative Name(s) | Tryptophan EP Impurity A;Tryptophan related compound A ;(2S,2S)-3,3-(1,1-(ethane-1,1-diyl)bis(1H-indole-3,1-diyl))bis(2-aminopropanoic acid) |
| Research Area | 1,1-Ethylidenebis[L-tryptophan] is a L-tryptophan contaminant found in the peripheral blood mononuclear cells from patients with functional somatic syndromes. |
| Molecular Formula | C24H26N4O4 |
| CAS# | 132685-02-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(N1C(C=CC=C2)=C2C(C[C@H](N)C(O)=O)=C1)N3C(C=CC=C4)=C4C(C[C@H](N)C(O)=O)=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST54496.html |
| Additional Information | NULL |