Sulfamerazine 13C6
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-02859 |
| Alternative Name(s) | 4-amino-N-(4-methylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)benzene-1-sulfonamide |
| Research Area | Labeled Sulfamerazine, intended for use as an internal standard for the quantification of Sulfamerazine by GC- or LC-mass spectrometry. |
| Molecular Formula | C5[13C]6H12N4O2S |
| CAS# | 1196157-80-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](NC1=NC=CC(C)=N1)([13C]2=[13CH][13CH]=[13C](N)[13CH]=[13CH]2)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02859.html |
| Additional Information | NULL |