Olanzapine Lactam Impurity
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-37864 |
| Alternative Name(s) | Olanzapine Lactam Impurity;(3Z)-1,3-Dihydro-4-(4-methyl-1-piperazinyl)-3-(2-oxopropylidene)-2H-1,5-benzodiazepin-2-one |
| Research Area | A degradation product of Olanzapine in solid oral formulations.;Impurity in commercial preparations of Olanzapine |
| Molecular Formula | C17H20N4O2 |
| CAS# | 1017241-34-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(/C=C1C(N2CCN(C)CC2)=NC3=CC=CC=C3NC/1=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST37864.html |
| Additional Information | NULL |
