4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic Acid Methyl Ester
Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-35050 |
| Alternative Name(s) | 4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic Acid Methyl Ester;Telmisartan Impurity;Methyl 7-methyl-2-propyl-5-benzimidazolecarboxylate |
| Research Area | 4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic Acid Methyl Ester is an intermediate in the synthesis of Telmisartan , an angiotensin II receptor antagonist. |
| Molecular Formula | C13H16N2O2 |
| CAS# | 152628-00-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=CC(C(OC)=O)=CC2=C1NC(CCC)=N2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST35050.html |
| Additional Information | NULL |