Baclofen D4 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06432 |
| Alternative Name(s) | Baclofen D4 Hydrochloride |
| Research Area | Labeled Baclofen, intended for use as an internal standard for the quantification of Baclofen by GC- or LC-mass spectrometry. |
| Molecular Formula | C10H9DCl2NO2 |
| CAS# | 1189938-30-4 (Freebase) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NCC(C(C([2H])=C1[2H])=C(C([2H])=C1Cl)[2H])CC(O)=O.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06432.html |
| Additional Information | NULL |