Thiethylperazine Maleate
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-02450 |
| Alternative Name(s) | 2-(ethylthio)-10-(3-(4-methylpiperazin-1-yl)propyl)-10H-phenothiazine dimaleate |
| Research Area | Thiethylperazine malate is a dopamine antagonist that is particularly useful in treating the nausea and vomiting associated with anesthesia, mildly emetic cancer chemotherapy agents, radiation therapy, and toxins. This piperazine phenothiazine does not pr |
| Molecular Formula | C30H37N3O8S2 |
| CAS# | 1179-69-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(/C=CC(O)=O)=O.CN1CCN(CC1)CCCN2C(C=C(SCC)C=C3)=C3SC4=CC=CC=C24.OC(/C=CC(O)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02450.html |
| Additional Information | NULL |
