Drospirenone 5,5'-Diol
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-53997 |
| Alternative Name(s) | Drospirenone 5,5-Diol;Drospirenone diol; impurity of Drospirenone;(2S,5R,6R,7R,8R,9S,10R,13S,14S,15S,16S-dimethylspiro[17H5,16]cyclopenta[a]phenanthrene-17,2(3H)-furan]-3(2H)-one; 5-Hydroxy Drospirenone Lactol Impurity; |
| Research Area | Drospirenone 5,5'-Diol is an impurity of Drospirenone . |
| Molecular Formula | NULL |
| CAS# | 863329-70-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1(CC[C@]2([H])[C@@](C)(CCC3=O)[C@]4(C3)O)[C@@]5(OC(O)CC5)[C@@H](C6)[C@@H]6[C@@]1([H])[C@]2([H])[C@@H]7[C@H]4C7 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST53997.html |
| Additional Information | NULL |