β-Gemcitabine 13C,15N2 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-14759 |
| Alternative Name(s) | 4-Amino-1-(2-deoxy-2,2-difluoro-b-D-erythro-pentofuranosyl)pyrimidin-2(1H)-one-1,3-15N2-13C hydrochloride. |
| Research Area | Labeled Gemcitabine , intended for use as an internal standard for the quantification of Gemcitabine by GC- or LC-mass spectrometry. |
| Molecular Formula | C8[13C]H12ClF2N[15N]2O4 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | FC1([C@@H]([15N](C=CC(N)=[15N]2)[13C]2=O)O[C@H](CO)[C@H]1O)F.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14759.html |
| Additional Information | NULL |