Sulfacetamide D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-13353 |
| Alternative Name(s) | N-[4-amino(D4)benzenesulfonyl]acetamide |
| Research Area | Labeled Sulfacetamide, intended for use as an internal standard for the quantification of Sulfacetamide by GC- or LC-mass spectrometry. |
| Molecular Formula | C8H6D4N2O3S |
| CAS# | 144-80-9 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](NC(C)=O)(C1=C([2H])C([2H])=C(N)C([2H])=C1[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13353.html |
| Additional Information | NULL |