Deferasirox D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06534 |
| Alternative Name(s) | 4-{bis[2-hydroxy(²H4)phenyl]-1H-1,2,4-triazol-1-yl}benzoc cid |
| Research Area | Labeled Deferasirox, intended for use as an internal standard for the quantification of Deferasirox by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H7D8N3O4 |
| CAS# | 201530-41-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C([2H])=C1[2H])=C(C([2H])=C1[2H])C2=NC(C(C([2H])=C3[2H])=C(C([2H])=C3[2H])O)=NN2C4=CC=C(C(O)=O)C=C4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06534.html |
| Additional Information | NULL |