Doxorubicin 13CD3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-14969 |
| Alternative Name(s) | (8S,10S)-10-{[(2R,4S,5S,6S)-4-amino-5-hydroxy-6- methyloxan-2-yl]oxy}-6,8,11-trihydroxy-8-(2- hydroxyacetyl)-1-(13C,D3)methoxy-5,7,8,9,10,12- hexahydrotetracene-5,12-dione |
| Research Area | Labeled Doxorubicin, intended for use as an internal standard for the quantification of Doxorubicin by GC- or LC-mass spectrometry. |
| Molecular Formula | C26[13C]H26D3NO11 |
| CAS# | 23214-92-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC1=C(C[C@](C(CO)=O)(O)C[C@@H]2O[C@@](O[C@@H](C)[C@H]3O)([H])C[C@@H]3N)C2=C(O)C(C4=O)=C1C(C5=CC=CC(O[13C]([2H])([2H])[2H])=C45)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14969.html |
| Additional Information | NULL |