Atenolol D7
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02815 |
| Alternative Name(s) | Atenolol-d7;2-[4-[(2RS)-2-Hydroxy-3-[(1-methylethyl-D7)amino]propoxy] phenyl]cetamide |
| Research Area | Atenolol Stable Isotope; Labeled Atenolol;Labeled Atenolol, intended for use as an internal standard for the quantification of Atenolol by GC- or LC-mass spectrometry. |
| Molecular Formula | C14H15D7N2O3 |
| CAS# | 1202864-50-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CNC(C([2H])([2H])[2H])([2H])C([2H])([2H])[2H])COC1=CC=C(CC(N)=O)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02815.html |
| Additional Information | NULL |