Voriconazole D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-07064 |
| Alternative Name(s) | Vorconazole-d3 (difluorophenyl-d3); (αR,βS)-α-(2,4-Difluorophenyl)-5-fluoro-β-(methyl-d3)-α-(1H-1,2,4-triazol-1-ylmethyl)-4-pyrimidineethanol; DRG 0301; UK-109496-d3; Vc-d3; Vfend-d3; Vorconazol-d3; |
| Research Area | Labeled Voriconazole, intended for use as an internal standard for the quantification of Voriconazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C16H11D3F3N5O |
| CAS# | 1217661-14-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](CN1C=NC=N1)(C(C=CC(F)=C2)=C2F)[C@H](C3=NC=NC=C3F)C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07064.html |
| Additional Information | NULL |