2-Methylcitric Acid
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-10343 |
| Alternative Name(s) | 2-hydroxy-1-methylpropane-1,2,3-tricarboxylic acid;2-hydroxy-1-methylpropane-1,2,3-tricarboxylic acid |
| Research Area | 2-Methylcitric Acid is a metabolite of Citric Acid . It is formed from the condensation of propionoyl-CoA and oxaloacetic acid catalyzed by a citrate synthase enzyme. |
| Molecular Formula | C7H10O7 |
| CAS# | 6061-96-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CC(O)=O)(C(O)=O)C(C)C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10343.html |
| Additional Information | NULL |