Metamizole Impurity C
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-31127 |
| Alternative Name(s) | 1,5-dimethyl-4-(methylamino)-2-phenyl-1H-pyrazol-3(2H)-onehydrochloride; CS-O-05980; Metamizole EP Impurity C; 1,2-Dihydro-1,5-dimethyl-4-(methylamino)-2-phenyl-3H-pyrazol-3-one; 4-Methylaminophenazone; 4-Monomethylaminoantipyrine; N-Methyl-4-aminoantipyrine; Noramidopyrine; Noraminopyrine; 4-Methylamino Antipyrine; CS-T-82171 |
| Research Area | Impurity in commercial preparations of Metamizole. A metabolite of Dipyrone, a nonsteroidal anti-inflammatory drug. |
| Molecular Formula | C12H15N3O |
| CAS# | 519-98-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1N(C2=CC=CC=C2)N(C)C(C)=C1NC.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31127.html |
| Additional Information | NULL |