Anidulafungin
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-07213 |
| Alternative Name(s) | N-((2R,6S,9S,11R,12R,14aS,15S,16S,20S,23S,25aS)-23-((1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl)-2,11,12,15-tetrahydroxy-6,20-bis((R)-1-hydroxyethyl)-16-methyl-5,8,14,19,22,25-hexaoxotetrcosahydro-1H-dipyrrolo[2,1c:2',1'-l][1,4,7,10,13,16]hexaazcclohencosin-9-yl)-4''-(pentyloxy)-[1,1':4',1''-terphenyl]-4carboxamide;Eraxis; calta; LY303366 |
| Research Area | Anidulafungin is a cyclic lipopeptide echinocandin derivative with antifungal activity. Anidulafungin inhibits 1,3 beta-D-glucan synthase, an enzyme involved in fungal cell wall synthesis, resulting in cell lysis and death. This agent is active against Ca |
| Molecular Formula | C58H73N7O17 |
| CAS# | 166663-25-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C([C@](NC(C(NC([C@@](C[C@@H](O)C1)([H])N1C2=O)=O)[C@H](O)[C@H](C3=CC=C(O)C=C3)O)=O)([H])[C@H](O)C)N4[C@@](C(N[C@@H]([C@@H](C[C@@H](C(NC2[C@H](O)C)=O)NC(C5=CC=C(C6=CC=C(C7=CC=C(OCCCCC)C=C7)C=C6)C=C5)=O)O)O)=O)([H])[C@@H](O)[C@@H](C)C4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07213.html |
| Additional Information | NULL |