Darifenacin D4 Hydrobromide
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-00698 |
| Alternative Name(s) | 2-[(3R)-1-[2-(2,3-dihydro-1-benzofuran-5-yl)(1,1,2,2-D4)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide hydrobromide; 2,2-diphenyl-2-[(3R)-1-[1,1,2,2-tetradeuterio-2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl]acetamide |
| Research Area | Used as a medication to treat urinary incontinence. It works by blocking the M3 muscarinic acetylcholine receptor.;Labeled Darifenacin, intended for use as an internal standard for the quantification of Darifenacin by GC- or LC-mass spectrometry. |
| Molecular Formula | C28H27D4BrN2O2 |
| CAS# | 1095598-84-7 (Freebase) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(C([C@H]1CN(C([2H])([2H])C([2H])([2H])C2=CC=C3C(CCO3)=C2)CC1)(C4=CC=CC=C4)C5=CC=CC=C5)=O.Br |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00698.html |
| Additional Information | NULL |